
|
| |
|---|---|
(169Kb)
|
51,168,000 Yen
Since it was found that chlorofluorocarbons(CFCs) currently in use destroy the ozone layer in the stratosphere, and tend to produce a global warming effect, it was decided to abolish them totally by the beginning of 1996. Consequently, in order to solve the CFCs problem, it has become most important to develop pollution-free CFCs alternatives.
To obtain the basic knowledge of new CFCs' alternatives, several new synthetic reactions were achieved. It means that synthesis of hydrochlorofluorocarbon(HCFC-253ca) from allene, new selective monofluorination of hydrofluorocarbon(HFC), synthesis of fluorine containing ether derivatives(HFEs) by fluorination of ether derivatives using fluorine gas or high valent metal fluoride as fluorination reagent, preparation of trifluoromethyl ether by addition of trifluoromethyl hypofluorite to ethylene derivatives, and so on.
The synthesized compounds were analyzed on some physical properties and environmental effect.
Synthesis, Fluorine, CFC, Alternatives